Compound Q&A

How is 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5) typically synthesized?

Answer

2-Methyl-2-propanyl (3-aminophenyl)carbamate
2-Methyl-2-propanyl (3-aminophenyl)carbamate is commonly synthesized via a multi-step process involving the reaction of 3-aminophenyl isocyanate with 2-methylpropyl alcohol. This synthesis typically employs a mild base catalyst to promote the reaction, yielding a product with high selectivity and good yield. The process requires careful handling to avoid side reactions and ensure purity.

About

CAS No 68621-88-5
English Name 2-Methyl-2-propanyl (3-aminophenyl)carbamate
Molecular Formula C11H16N2O2
Molecular Weight 208.26 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=CC(=C1)N
InChIKey IEUIEMIRUXSXCL-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

2-Methyl-2-propanyl (3-aminophenyl)carbamate is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

2-Methyl-2-propanyl (3-aminophenyl)carbamate finds application in various industries, including phar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate (CAS: 68621-88-5)?

When handling 2-Methyl-2-propanyl (3-aminophenyl)carbamate, it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...