Compound Q&A

What precautions should be taken when handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

Answer

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
When handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate, appropriate personal protective equipment (PPE) such as gloves, lab coat, and safety goggles should be worn. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. Safety data sheets (SDS) should be consulted for specific handling and disposal instructions.

About

CAS No 302-22-7
English Name 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C23H29ClO4
Molecular Weight 404.93 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)CCC34C)Cl)C)OC(=O)C
InChIKey QMBJSIBWORFWQT-DFXBJWIESA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

The physical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate include a white crystall...

Compound Q&A

How is 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7) typically synthesized?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is typically synthesized through a series of reacti...

Compound Q&A

What industries use 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is primarily used in the pharmaceutical industry as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...