Compound Q&A

What industries use 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

Answer

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is primarily used in the pharmaceutical industry as an intermediate in the synthesis of corticosteroids and other steroid derivatives. It is also used in the production of certain synthetic hormones and in research applications related to steroid chemistry.

About

CAS No 302-22-7
English Name 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C23H29ClO4
Molecular Weight 404.93 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)CCC34C)Cl)C)OC(=O)C
InChIKey QMBJSIBWORFWQT-DFXBJWIESA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

The physical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate include a white crystall...

Compound Q&A

How is 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7) typically synthesized?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is typically synthesized through a series of reacti...

Compound Q&A

What precautions should be taken when handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

When handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate, appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...