Compound Q&A

How is 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7) typically synthesized?

Answer

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is typically synthesized through a series of reactions involving the conversion of progesterone to the 17-oxo derivative followed by acetylation. The synthesis requires careful control of reaction conditions to achieve high selectivity and yield. Commonly used catalysts include strong acids like sulfuric acid, and the process involves an esterification step.

About

CAS No 302-22-7
English Name 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C23H29ClO4
Molecular Weight 404.93 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)CCC34C)Cl)C)OC(=O)C
InChIKey QMBJSIBWORFWQT-DFXBJWIESA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

The physical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate include a white crystall...

Compound Q&A

What industries use 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

When handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate, appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...