Compound Q&A

What are the physical and chemical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

Answer

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
The physical properties of 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate include a white crystalline form with a molecular weight of approximately 416.08 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive and can undergo ester hydrolysis and nucleophilic substitution reactions.

About

CAS No 302-22-7
English Name 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate
Molecular Formula C23H29ClO4
Molecular Weight 404.93 g/mol
SMILES CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)CCC34C)Cl)C)OC(=O)C
InChIKey QMBJSIBWORFWQT-DFXBJWIESA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7) typically synthesized?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is typically synthesized through a series of reacti...

Compound Q&A

What industries use 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate (CAS: 302-22-7)?

When handling 6-Chloro-3,20-dioxopregna-4,6-dien-17-yl acetate, appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...