Compound Q&A

What industries use (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

Answer

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid finds applications in pharmaceuticals, where it serves as a precursor in the synthesis of certain drugs. It is also used in the development of sensors for detecting specific compounds and in the production of certain polymers. Due to its unique chemical properties, it is explored in semiconductor applications for its potential role in material science.

About

CAS No 4702-13-0
English Name (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
Molecular Formula C10H7NO4
Molecular Weight 205.17 g/mol
SMILES OC(=O)CN1C(=O)c2ccccc2C1=O
InChIKey WQINSVOOIJDOLJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is a crystalline solid with a molecular weight o...

Compound Q&A

How is (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0) typically synthesized?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is often synthesized via the condensation of 1,3...

Compound Q&A

What precautions should be taken when handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

When handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...