Compound Q&A

What are the physical and chemical properties of (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

Answer

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is a crystalline solid with a molecular weight of approximately 236.25 g/mol. It has a melting point of around 165-168°C and is slightly soluble in water. The compound is reactive under certain conditions, particularly in the presence of strong acids or bases. It displays good stability in air and is not particularly volatile.

About

CAS No 4702-13-0
English Name (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
Molecular Formula C10H7NO4
Molecular Weight 205.17 g/mol
SMILES OC(=O)CN1C(=O)c2ccccc2C1=O
InChIKey WQINSVOOIJDOLJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0) typically synthesized?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is often synthesized via the condensation of 1,3...

Compound Q&A

What industries use (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid finds applications in pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

When handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...