Compound Q&A

How is (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0) typically synthesized?

Answer

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is often synthesized via the condensation of 1,3-dioxo-1,3-dihydro-2H-isoindole-2-carboxaldehyde with acetic anhydride. The reaction is typically conducted in the presence of a catalyst to ensure high selectivity and yield. Commonly used solvents include dichloromethane or acetonitrile.

About

CAS No 4702-13-0
English Name (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid
Molecular Formula C10H7NO4
Molecular Weight 205.17 g/mol
SMILES OC(=O)CN1C(=O)c2ccccc2C1=O
InChIKey WQINSVOOIJDOLJ-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid finds applications in pharmaceuticals, where it ...

Compound Q&A

What precautions should be taken when handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid (CAS: 4702-13-0)?

When handling (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetic acid, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...