Compound Q&A

What precautions should be taken when handling 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

Answer

5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
When handling 5-Isoquinolinesulfonyl chloride hydrochloride, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or under a fume hood due to its volatility and reactivity. Spills should be cleaned up immediately with appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed handling and disposal procedures.

About

English Name 5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
Molecular Formula C9H7Cl2NO2S
Molecular Weight 264.13 g/mol
SMILES C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)Cl.Cl
InChIKey GZQNTWHQJJVIAK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

5-Isoquinolinesulfonyl chloride hydrochloride is a white crystalline solid. It has a molecular weigh...

Compound Q&A

How is 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0) typically synthesized?

5-Isoquinolinesulfonyl chloride hydrochloride is typically synthesized by reacting isoquinoline with...

Compound Q&A

What industries use 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

5-Isoquinolinesulfonyl chloride hydrochloride is used in the pharmaceutical industry, where it serve...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...