Compound Q&A

What are the physical and chemical properties of 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

Answer

5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
5-Isoquinolinesulfonyl chloride hydrochloride is a white crystalline solid. It has a molecular weight of approximately 277.66 g/mol. This compound is sparingly soluble in water but soluble in common organic solvents. It is highly reactive, particularly under acidic conditions, and can undergo substitution reactions easily.

About

English Name 5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
Molecular Formula C9H7Cl2NO2S
Molecular Weight 264.13 g/mol
SMILES C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)Cl.Cl
InChIKey GZQNTWHQJJVIAK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0) typically synthesized?

5-Isoquinolinesulfonyl chloride hydrochloride is typically synthesized by reacting isoquinoline with...

Compound Q&A

What industries use 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

5-Isoquinolinesulfonyl chloride hydrochloride is used in the pharmaceutical industry, where it serve...

Compound Q&A

What precautions should be taken when handling 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

When handling 5-Isoquinolinesulfonyl chloride hydrochloride, it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...