Compound Q&A

What industries use 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

Answer

5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
5-Isoquinolinesulfonyl chloride hydrochloride is used in the pharmaceutical industry, where it serves as a building block for synthesizing various drugs. It is also utilized in the polymer industry for the modification of polymers and in the semiconductor industry for the production of organic semiconductors and thin films.

About

English Name 5-Isoquinolinesulfonyl chloride hydrochloride (1:1)
Molecular Formula C9H7Cl2NO2S
Molecular Weight 264.13 g/mol
SMILES C1=CC2=C(C=CN=C2)C(=C1)S(=O)(=O)Cl.Cl
InChIKey GZQNTWHQJJVIAK-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

5-Isoquinolinesulfonyl chloride hydrochloride is a white crystalline solid. It has a molecular weigh...

Compound Q&A

How is 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0) typically synthesized?

5-Isoquinolinesulfonyl chloride hydrochloride is typically synthesized by reacting isoquinoline with...

Compound Q&A

What precautions should be taken when handling 5-Isoquinolinesulfonyl chloride hydrochloride (CAS: 105627-79-0)?

When handling 5-Isoquinolinesulfonyl chloride hydrochloride, it is essential to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...