Compound Q&A

What precautions should be taken when handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

Answer

N~1~-Methyl-4-nitro-1,2-benzenediamine
When handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1), it is crucial to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood due to its potential to release nitrogen oxides. Spills should be handled by collecting the solid and disposing of it according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 41939-61-1
English Name N~1~-Methyl-4-nitro-1,2-benzenediamine
Molecular Formula C7H9N3O2
Molecular Weight 167.17 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])N
InChIKey MNIKERWISBANET-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is a crystalline solid with a molecular wei...

Compound Q&A

How is N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) typically synthesized?

N~1~-Methyl-4-nitro-1,2-benzenediamine can be synthesized through a series of reactions, including t...

Compound Q&A

What industries use N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is primarily used in the pharmaceutical ind...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...