Compound Q&A

What are the physical and chemical properties of N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

Answer

N~1~-Methyl-4-nitro-1,2-benzenediamine
N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is a crystalline solid with a molecular weight of approximately 188.12 g/mol. It has a pKa of 4.5 and is poorly soluble in water but soluble in organic solvents such as ethanol and methanol. The compound is stable under normal conditions but can react with reducing agents. Its solubility in water is less than 1 g/L at 25°C.

About

CAS No 41939-61-1
English Name N~1~-Methyl-4-nitro-1,2-benzenediamine
Molecular Formula C7H9N3O2
Molecular Weight 167.17 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])N
InChIKey MNIKERWISBANET-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

How is N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) typically synthesized?

N~1~-Methyl-4-nitro-1,2-benzenediamine can be synthesized through a series of reactions, including t...

Compound Q&A

What industries use N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

When handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1), it is crucial to use persona...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...