Compound Q&A

What industries use N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

Answer

N~1~-Methyl-4-nitro-1,2-benzenediamine
N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It also finds applications in the manufacture of dyes, pigments, and as a component in some industrial catalysts. Its use in electronics and semiconductors is limited due to its chemical reactivity.

About

CAS No 41939-61-1
English Name N~1~-Methyl-4-nitro-1,2-benzenediamine
Molecular Formula C7H9N3O2
Molecular Weight 167.17 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])N
InChIKey MNIKERWISBANET-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is a crystalline solid with a molecular wei...

Compound Q&A

How is N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) typically synthesized?

N~1~-Methyl-4-nitro-1,2-benzenediamine can be synthesized through a series of reactions, including t...

Compound Q&A

What precautions should be taken when handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

When handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1), it is crucial to use persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...