Compound Q&A

How is N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) typically synthesized?

Answer

N~1~-Methyl-4-nitro-1,2-benzenediamine
N~1~-Methyl-4-nitro-1,2-benzenediamine can be synthesized through a series of reactions, including the nitration of 1,2-benzenediamine followed by methylation. Common methods involve the use of nitric acid and sulfuric acid as reagents. The reaction is exothermic, and proper cooling and handling of reactants are necessary to ensure safety and yield.

About

CAS No 41939-61-1
English Name N~1~-Methyl-4-nitro-1,2-benzenediamine
Molecular Formula C7H9N3O2
Molecular Weight 167.17 g/mol
SMILES CNC1=C(C=C(C=C1)[N+](=O)[O-])N
InChIKey MNIKERWISBANET-UHFFFAOYSA-N
Last Updated: 2025-09-09 19:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1)?

When handling N~1~-Methyl-4-nitro-1,2-benzenediamine (CAS: 41939-61-1), it is crucial to use persona...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...