Compound Q&A

What precautions should be taken when handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

Answer

7-Amino-1,3,6-naphthalenetrisulfonic acid
When handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. The compound should be stored in a well-ventilated area and away from strong oxidizers and acids. In the event of a spill, the area should be cleaned up immediately with water and appropriate absorbents. The material safety data sheet (MSDS) should always be consulted for detailed safety information and emergency procedures. Handling should be conducted in a fume hood to prevent inhalation exposure.

About

CAS No 118-03-6
English Name 7-Amino-1,3,6-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.38 g/mol
SMILES C1=C2C=C(C(=CC2=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N)S(=O)(=O)O
InChIKey GFPQSWFFPRQEHH-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is a crystalline compound with a molecular...

Compound Q&A

How is 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) typically synthesized?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is typically synthesized through a multi-s...

Compound Q&A

What industries use 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) finds applications in various industries. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...