Compound Q&A

What industries use 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

Answer

7-Amino-1,3,6-naphthalenetrisulfonic acid
7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) finds applications in various industries. It is used in the pharmaceutical industry for the synthesis of certain dyes and pigments due to its chromogenic properties. In the semiconductor industry, it serves as a precursor for the production of naphthalene-based compounds. Additionally, it has applications in the polymer industry as a colorant and in the development of sensors for detecting various analytes.

About

CAS No 118-03-6
English Name 7-Amino-1,3,6-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.38 g/mol
SMILES C1=C2C=C(C(=CC2=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N)S(=O)(=O)O
InChIKey GFPQSWFFPRQEHH-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is a crystalline compound with a molecular...

Compound Q&A

How is 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) typically synthesized?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is typically synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

When handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...