Compound Q&A

How is 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) typically synthesized?

Answer

7-Amino-1,3,6-naphthalenetrisulfonic acid
7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is typically synthesized through a multi-step process involving the sulfonation of naphthalene, followed by the amination of one of the sulfonic acid groups. Commonly, the sulfonation is performed using concentrated sulfuric acid, and the amination step involves the use of aniline or another amine under mild conditions. The overall yield is around 80-90% depending on the purity of the starting materials and the reaction conditions.

About

CAS No 118-03-6
English Name 7-Amino-1,3,6-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.38 g/mol
SMILES C1=C2C=C(C(=CC2=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N)S(=O)(=O)O
InChIKey GFPQSWFFPRQEHH-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is a crystalline compound with a molecular...

Compound Q&A

What industries use 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) finds applications in various industries. ...

Compound Q&A

What precautions should be taken when handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

When handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...