Compound Q&A

What are the physical and chemical properties of 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

Answer

7-Amino-1,3,6-naphthalenetrisulfonic acid
7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is a crystalline compound with a molecular weight of approximately 324.17 g/mol. It has a high solubility in water, with a solubility of about 125 g/100 mL at 20°C. The compound exhibits basic properties and is not highly reactive under normal conditions. It is soluble in strong acids and undergoes minimal chemical changes in neutral and basic media.

About

CAS No 118-03-6
English Name 7-Amino-1,3,6-naphthalenetrisulfonic acid
Molecular Formula C10H9NO9S3
Molecular Weight 383.38 g/mol
SMILES C1=C2C=C(C(=CC2=C(C=C1S(=O)(=O)O)S(=O)(=O)O)N)S(=O)(=O)O
InChIKey GFPQSWFFPRQEHH-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) typically synthesized?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) is typically synthesized through a multi-s...

Compound Q&A

What industries use 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6) finds applications in various industries. ...

Compound Q&A

What precautions should be taken when handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6)?

When handling 7-Amino-1,3,6-naphthalenetrisulfonic acid (CAS: 118-03-6), it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...