Compound Q&A

What precautions should be taken when handling 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

Answer

1-(2-Fluoro-5-nitrophenyl)ethanone
When handling 1-(2-Fluoro-5-nitrophenyl)ethanone, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store it in a cool, dry place, away from direct sunlight and heat sources. Use a fume hood during handling, and follow standard laboratory safety protocols. In case of a spill, neutralize it with an appropriate chemical neutralizer and dispose of it according to local regulations. Always refer to the safety data sheet (SDS) for detailed information on handling procedures.

About

CAS No 79110-05-7
English Name 1-(2-Fluoro-5-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.14 g/mol
SMILES CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey BCXOSCQTHVTUET-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

1-(2-Fluoro-5-nitrophenyl)ethanone is a white or off-white crystalline solid with a molecular weight...

Compound Q&A

How is 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7) typically synthesized?

1-(2-Fluoro-5-nitrophenyl)ethanone can be synthesized through the reaction of 2-fluoro-5-nitrobenzal...

Compound Q&A

What industries use 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

1-(2-Fluoro-5-nitrophenyl)ethanone is used in the pharmaceutical and chemical industries for the syn...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...