Compound Q&A

What industries use 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

Answer

1-(2-Fluoro-5-nitrophenyl)ethanone
1-(2-Fluoro-5-nitrophenyl)ethanone is used in the pharmaceutical and chemical industries for the synthesis of intermediates and active pharmaceutical ingredients. It also finds applications in the development of sensors and materials for electronic devices due to its functional groups that can participate in various chemical reactions.

About

CAS No 79110-05-7
English Name 1-(2-Fluoro-5-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.14 g/mol
SMILES CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey BCXOSCQTHVTUET-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

1-(2-Fluoro-5-nitrophenyl)ethanone is a white or off-white crystalline solid with a molecular weight...

Compound Q&A

How is 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7) typically synthesized?

1-(2-Fluoro-5-nitrophenyl)ethanone can be synthesized through the reaction of 2-fluoro-5-nitrobenzal...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

When handling 1-(2-Fluoro-5-nitrophenyl)ethanone, it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...