Compound Q&A

What are the physical and chemical properties of 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

Answer

1-(2-Fluoro-5-nitrophenyl)ethanone
1-(2-Fluoro-5-nitrophenyl)ethanone is a white or off-white crystalline solid with a molecular weight of approximately 214.07 g/mol. It has a solubility of about 7.4 g/L in water at 20°C and is moderately soluble in organic solvents like ethanol and acetone. Chemically, it is a ketone with a high reactivity towards nucleophiles and reducing agents. It undergoes nitro group reduction and fluoro substitution under appropriate conditions.

About

CAS No 79110-05-7
English Name 1-(2-Fluoro-5-nitrophenyl)ethanone
Molecular Formula C8H6FNO3
Molecular Weight 183.14 g/mol
SMILES CC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])F
InChIKey BCXOSCQTHVTUET-UHFFFAOYSA-N
Last Updated: 2025-09-09 08:06

Related Q&A

Compound Q&A

How is 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7) typically synthesized?

1-(2-Fluoro-5-nitrophenyl)ethanone can be synthesized through the reaction of 2-fluoro-5-nitrobenzal...

Compound Q&A

What industries use 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

1-(2-Fluoro-5-nitrophenyl)ethanone is used in the pharmaceutical and chemical industries for the syn...

Compound Q&A

What precautions should be taken when handling 1-(2-Fluoro-5-nitrophenyl)ethanone (CAS: 79110-05-7)?

When handling 1-(2-Fluoro-5-nitrophenyl)ethanone, it is crucial to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...