Compound Q&A

What precautions should be taken when handling (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

Answer

(4-Nitrophenyl)boronic acid
When handling (4-Nitrophenyl)boronic acid, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to avoid exposure to the air. Spills should be cleaned up carefully using appropriate chemicals, and the area should be thoroughly rinsed. Always refer to the Material Safety Data Sheet (MSDS) for specific handling instructions.

About

CAS No 24067-17-2
English Name (4-Nitrophenyl)boronic acid
Molecular Formula C6H6BNO4
Molecular Weight 166.93 g/mol
EINECS 627-647-7
SMILES B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O
InChIKey NSFJAFZHYOAMHL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

(4-Nitrophenyl)boronic acid is a white crystalline solid with a molecular weight of 232.07 g/mol. It...

Compound Q&A

How is (4-Nitrophenyl)boronic acid (CAS: 24067-17-2) typically synthesized?

(4-Nitrophenyl)boronic acid is typically synthesized through the esterification of phenylboronic aci...

Compound Q&A

What industries use (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

(4-Nitrophenyl)boronic acid is used in various industries including pharmaceuticals, where it is use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...