Compound Q&A

What are the physical and chemical properties of (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

Answer

(4-Nitrophenyl)boronic acid
(4-Nitrophenyl)boronic acid is a white crystalline solid with a molecular weight of 232.07 g/mol. It has a solubility of 2.4 g/L in water and exhibits moderate solubility in organic solvents. It is a weak acid and is known for its reactivity in boronate ester formation and its use in Suzuki coupling reactions.

About

CAS No 24067-17-2
English Name (4-Nitrophenyl)boronic acid
Molecular Formula C6H6BNO4
Molecular Weight 166.93 g/mol
EINECS 627-647-7
SMILES B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O
InChIKey NSFJAFZHYOAMHL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is (4-Nitrophenyl)boronic acid (CAS: 24067-17-2) typically synthesized?

(4-Nitrophenyl)boronic acid is typically synthesized through the esterification of phenylboronic aci...

Compound Q&A

What industries use (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

(4-Nitrophenyl)boronic acid is used in various industries including pharmaceuticals, where it is use...

Compound Q&A

What precautions should be taken when handling (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

When handling (4-Nitrophenyl)boronic acid, it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...