Compound Q&A

What industries use (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

Answer

(4-Nitrophenyl)boronic acid
(4-Nitrophenyl)boronic acid is used in various industries including pharmaceuticals, where it is used as a substrate in reactions such as Suzuki coupling for drug synthesis. It is also used in the polymer industry for the modification of polymers, and in the semiconductor industry for the production of electronic materials.

About

CAS No 24067-17-2
English Name (4-Nitrophenyl)boronic acid
Molecular Formula C6H6BNO4
Molecular Weight 166.93 g/mol
EINECS 627-647-7
SMILES B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O
InChIKey NSFJAFZHYOAMHL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

(4-Nitrophenyl)boronic acid is a white crystalline solid with a molecular weight of 232.07 g/mol. It...

Compound Q&A

How is (4-Nitrophenyl)boronic acid (CAS: 24067-17-2) typically synthesized?

(4-Nitrophenyl)boronic acid is typically synthesized through the esterification of phenylboronic aci...

Compound Q&A

What precautions should be taken when handling (4-Nitrophenyl)boronic acid (CAS: 24067-17-2)?

When handling (4-Nitrophenyl)boronic acid, it is important to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...