Compound Q&A

What precautions should be taken when handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Answer

Dimethyl 2,6-naphthalenedicarboxylate
When handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3), it is important to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be stored in a fume hood to minimize inhalation risks. In case of a spill, the area should be ventilated and the substance should be handled with caution. Always refer to the Safety Data Sheet (SDS) for detailed guidelines on handling and emergency procedures.

About

CAS No 840-65-3
English Name Dimethyl 2,6-naphthalenedicarboxylate
Molecular Formula C14H12O4
Molecular Weight 244.24599999999998 g/mol
SMILES O=C(C1=CC=C2C=C(C(OC)=O)C=CC2=C1)OC
InChIKey GYUVMLBYMPKZAZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is a crystalline compound with a molecular wei...

Compound Q&A

How is Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) typically synthesized?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is typically synthesized by the esterification...

Compound Q&A

What industries use Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is used in various industries, including pharm...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...