Compound Q&A

How is Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) typically synthesized?

Answer

Dimethyl 2,6-naphthalenedicarboxylate
Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is typically synthesized by the esterification of 2,6-naphthalenedicarboxylic acid with dimethyl alcohol. The reaction is catalyzed by acid or base catalysts and often involves the use of a solvent like acetic acid. The yield is usually high, around 90%, and the product is typically obtained in a crystalline form.

About

CAS No 840-65-3
English Name Dimethyl 2,6-naphthalenedicarboxylate
Molecular Formula C14H12O4
Molecular Weight 244.24599999999998 g/mol
SMILES O=C(C1=CC=C2C=C(C(OC)=O)C=CC2=C1)OC
InChIKey GYUVMLBYMPKZAZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is a crystalline compound with a molecular wei...

Compound Q&A

What industries use Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

When handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3), it is important to use personal...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...