Compound Q&A

What are the physical and chemical properties of Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Answer

Dimethyl 2,6-naphthalenedicarboxylate
Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is a crystalline compound with a molecular weight of approximately 238.27 g/mol. It has a high solubility in organic solvents like acetone and methanol but is insoluble in water. Chemically, it is relatively stable but can undergo ester exchange reactions under certain conditions. It is used in the synthesis of organic materials and pharmaceuticals.

About

CAS No 840-65-3
English Name Dimethyl 2,6-naphthalenedicarboxylate
Molecular Formula C14H12O4
Molecular Weight 244.25 g/mol
SMILES O=C(C1=CC=C2C=C(C(OC)=O)C=CC2=C1)OC
InChIKey GYUVMLBYMPKZAZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) typically synthesized?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is typically synthesized by the esterification...

Compound Q&A

What industries use Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is used in various industries, including pharm...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

When handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3), it is important to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...