Compound Q&A

What industries use Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Answer

Dimethyl 2,6-naphthalenedicarboxylate
Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is used in various industries, including pharmaceuticals, where it serves as a building block for drug molecules, and polymers, where it contributes to the development of high-performance materials. It is also used in the manufacturing of semiconductors and sensors due to its electronic properties.

About

CAS No 840-65-3
English Name Dimethyl 2,6-naphthalenedicarboxylate
Molecular Formula C14H12O4
Molecular Weight 244.25 g/mol
SMILES O=C(C1=CC=C2C=C(C(OC)=O)C=CC2=C1)OC
InChIKey GYUVMLBYMPKZAZ-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is a crystalline compound with a molecular wei...

Compound Q&A

How is Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) typically synthesized?

Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3) is typically synthesized by the esterification...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3)?

When handling Dimethyl 2,6-naphthalenedicarboxylate (CAS: 840-65-3), it is important to use personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...