Compound Q&A

What industries use 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

Answer

2'-Deoxyguanosine hydrate (1:1)
2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is primarily used in the pharmaceutical industry for the synthesis of nucleoside analogs used in the treatment of viral and bacterial infections. It is also utilized in the research and development of DNA and RNA-based biosensors and in the production of semiconductors as a dopant material.

About

English Name 2'-Deoxyguanosine hydrate (1:1)
Molecular Formula C10H15N5O5
Molecular Weight 285.26 g/mol
SMILES C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O.O
InChIKey LZSCQUCOIRGCEJ-FPKZOZHISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is a white crystalline solid with a molecular weight of...

Compound Q&A

How is 2'-Deoxyguanosine hydrate (CAS: 312693-72-4) typically synthesized?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is typically synthesized via the condensation of 2'-deo...

Compound Q&A

What precautions should be taken when handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

When handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...