Compound Q&A

What are the physical and chemical properties of 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

Answer

2'-Deoxyguanosine hydrate (1:1)
2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is a white crystalline solid with a molecular weight of approximately 318.2 g/mol. It has a solubility of 0.14 g/100 mL in water and is moderately reactive, particularly in acidic conditions. It is stable under normal storage conditions but can degrade upon exposure to moisture or heat.

About

English Name 2'-Deoxyguanosine hydrate (1:1)
Molecular Formula C10H15N5O5
Molecular Weight 285.26 g/mol
SMILES C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O.O
InChIKey LZSCQUCOIRGCEJ-FPKZOZHISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2'-Deoxyguanosine hydrate (CAS: 312693-72-4) typically synthesized?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is typically synthesized via the condensation of 2'-deo...

Compound Q&A

What industries use 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

When handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...