Compound Q&A

How is 2'-Deoxyguanosine hydrate (CAS: 312693-72-4) typically synthesized?

Answer

2'-Deoxyguanosine hydrate (1:1)
2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is typically synthesized via the condensation of 2'-deoxyadenosine-5'-phosphate with guanidine in the presence of a catalyst such as sodium hydroxide. The reaction is carried out in an aqueous medium, and the product is purified by recrystallization from water, yielding a hydrate with a 1:1 ratio of 2'-deoxyguanosine to water.

About

English Name 2'-Deoxyguanosine hydrate (1:1)
Molecular Formula C10H15N5O5
Molecular Weight 285.26 g/mol
SMILES C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O.O
InChIKey LZSCQUCOIRGCEJ-FPKZOZHISA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is a white crystalline solid with a molecular weight of...

Compound Q&A

What industries use 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

2'-Deoxyguanosine hydrate (CAS: 312693-72-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4)?

When handling 2'-Deoxyguanosine hydrate (CAS: 312693-72-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...