Compound Q&A

What precautions should be taken when handling Cefamandole nafate (CAS: 42540-40-9)?

Answer

Cefamandole nafate
When handling Cefamandole nafate (CAS: 42540-40-9), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Operations should be conducted in a well-ventilated area or fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate absorbents, and the area should be thoroughly washed with water. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 42540-40-9
English Name Cefamandole nafate
Molecular Formula C19H17N6NaO6S2
Molecular Weight 512.5 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(C4=CC=CC=C4)OC=O)SC2)C(=O)[O-].[Na+]
InChIKey ICZOIXFFVKYXOM-YCLOEFEOSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is Cefamandole nafate (CAS: 42540-40-9) typically synthesized?

Cefamandole nafate (CAS: 42540-40-9) is synthesized through a multi-step process involving the acyla...

Compound Q&A

What industries use Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is primarily used in the pharmaceutical industry for the produc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...