Compound Q&A

What are the physical and chemical properties of Cefamandole nafate (CAS: 42540-40-9)?

Answer

Cefamandole nafate
Cefamandole nafate (CAS: 42540-40-9) is a crystalline compound with a molecular weight of approximately 482.5 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol. Chemically, it is relatively stable but can react with strong acids or bases. It is used in pharmaceutical formulations for its antimicrobial properties.

About

CAS No 42540-40-9
English Name Cefamandole nafate
Molecular Formula C19H17N6NaO6S2
Molecular Weight 512.5 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(C4=CC=CC=C4)OC=O)SC2)C(=O)[O-].[Na+]
InChIKey ICZOIXFFVKYXOM-YCLOEFEOSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is Cefamandole nafate (CAS: 42540-40-9) typically synthesized?

Cefamandole nafate (CAS: 42540-40-9) is synthesized through a multi-step process involving the acyla...

Compound Q&A

What industries use Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is primarily used in the pharmaceutical industry for the produc...

Compound Q&A

What precautions should be taken when handling Cefamandole nafate (CAS: 42540-40-9)?

When handling Cefamandole nafate (CAS: 42540-40-9), it is essential to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...