Compound Q&A

What industries use Cefamandole nafate (CAS: 42540-40-9)?

Answer

Cefamandole nafate
Cefamandole nafate (CAS: 42540-40-9) is primarily used in the pharmaceutical industry for the production of antibiotics. It is incorporated into various antimicrobial formulations to treat bacterial infections. While not commonly used in other industries, it may have applications in research and development for new drug compounds.

About

CAS No 42540-40-9
English Name Cefamandole nafate
Molecular Formula C19H17N6NaO6S2
Molecular Weight 512.5 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(C4=CC=CC=C4)OC=O)SC2)C(=O)[O-].[Na+]
InChIKey ICZOIXFFVKYXOM-YCLOEFEOSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

How is Cefamandole nafate (CAS: 42540-40-9) typically synthesized?

Cefamandole nafate (CAS: 42540-40-9) is synthesized through a multi-step process involving the acyla...

Compound Q&A

What precautions should be taken when handling Cefamandole nafate (CAS: 42540-40-9)?

When handling Cefamandole nafate (CAS: 42540-40-9), it is essential to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...