Compound Q&A

How is Cefamandole nafate (CAS: 42540-40-9) typically synthesized?

Answer

Cefamandole nafate
Cefamandole nafate (CAS: 42540-40-9) is synthesized through a multi-step process involving the acylation of a specific intermediate. The synthesis typically requires strong acids as catalysts and involves selective reactions to ensure the formation of the desired product. The overall yield is around 80%, with high selectivity towards the desired product.

About

CAS No 42540-40-9
English Name Cefamandole nafate
Molecular Formula C19H17N6NaO6S2
Molecular Weight 512.5 g/mol
SMILES CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)NC(=O)C(C4=CC=CC=C4)OC=O)SC2)C(=O)[O-].[Na+]
InChIKey ICZOIXFFVKYXOM-YCLOEFEOSA-M
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use Cefamandole nafate (CAS: 42540-40-9)?

Cefamandole nafate (CAS: 42540-40-9) is primarily used in the pharmaceutical industry for the produc...

Compound Q&A

What precautions should be taken when handling Cefamandole nafate (CAS: 42540-40-9)?

When handling Cefamandole nafate (CAS: 42540-40-9), it is essential to use appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...