Compound Q&A

What precautions should be taken when handling 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

Answer

2,5-Dichloronicotinic acid
When handling 2,5-Dichloronicotinic acid, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. It should be stored in a dry, cool place away from direct sunlight. Spills should be cleaned up using appropriate absorbents and collected for proper disposal. Always consult the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 59782-85-3
English Name 2,5-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)Cl
InChIKey SXQSMLIMBNMUNB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

2,5-Dichloronicotinic acid is a crystalline solid with a molecular weight of approximately 225.02 g/...

Compound Q&A

How is 2,5-Dichloronicotinic acid (CAS: 59782-85-3) typically synthesized?

2,5-Dichloronicotinic acid can be synthesized by chlorinating nicotinic acid in a chlorination react...

Compound Q&A

What industries use 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

2,5-Dichloronicotinic acid is used in the pharmaceutical industry for the synthesis of certain drugs...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...