Compound Q&A

What are the physical and chemical properties of 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

Answer

2,5-Dichloronicotinic acid
2,5-Dichloronicotinic acid is a crystalline solid with a molecular weight of approximately 225.02 g/mol. It has a solubility of about 9.0 g/L in water at 25°C. The compound exhibits acidity and undergoes redox reactions. It is prone to hydrolysis under basic conditions.

About

CAS No 59782-85-3
English Name 2,5-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)Cl
InChIKey SXQSMLIMBNMUNB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2,5-Dichloronicotinic acid (CAS: 59782-85-3) typically synthesized?

2,5-Dichloronicotinic acid can be synthesized by chlorinating nicotinic acid in a chlorination react...

Compound Q&A

What industries use 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

2,5-Dichloronicotinic acid is used in the pharmaceutical industry for the synthesis of certain drugs...

Compound Q&A

What precautions should be taken when handling 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

When handling 2,5-Dichloronicotinic acid, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...