Compound Q&A

What industries use 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

Answer

2,5-Dichloronicotinic acid
2,5-Dichloronicotinic acid is used in the pharmaceutical industry for the synthesis of certain drugs. It is also employed in the chemical industry for the production of dyes and other chemical intermediates. Additionally, it has applications in polymer synthesis and as a reagent in analytical chemistry.

About

CAS No 59782-85-3
English Name 2,5-Dichloronicotinic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)Cl
InChIKey SXQSMLIMBNMUNB-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

2,5-Dichloronicotinic acid is a crystalline solid with a molecular weight of approximately 225.02 g/...

Compound Q&A

How is 2,5-Dichloronicotinic acid (CAS: 59782-85-3) typically synthesized?

2,5-Dichloronicotinic acid can be synthesized by chlorinating nicotinic acid in a chlorination react...

Compound Q&A

What precautions should be taken when handling 2,5-Dichloronicotinic acid (CAS: 59782-85-3)?

When handling 2,5-Dichloronicotinic acid, appropriate personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...