Compound Q&A

What precautions should be taken when handling Azithromycin hydrate (CAS: 117772-70-0)?

Answer

Azithromycin hydrate
When handling Azithromycin hydrate, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate materials, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed safety guidelines.

About

English Name Azithromycin hydrate
Molecular Formula C38H76N2O14
Molecular Weight 749 g/mol
SMILES CCC1C(C(C(N(CC(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)C)O)(C)O.O.O
InChIKey MQTOSJVFKKJCRP-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azithromycin hydrate (CAS: 117772-70-0)?

Azithromycin hydrate is an amorphous form of azithromycin with a molecular weight of approximately 9...

Compound Q&A

How is Azithromycin hydrate (CAS: 117772-70-0) typically synthesized?

Azithromycin hydrate is synthesized through a multi-step process involving a key intermediate, 15-de...

Compound Q&A

What industries use Azithromycin hydrate (CAS: 117772-70-0)?

Azithromycin hydrate is primarily used in the pharmaceutical industry for the treatment of various b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...