Compound Q&A

What industries use Azithromycin hydrate (CAS: 117772-70-0)?

Answer

Azithromycin hydrate
Azithromycin hydrate is primarily used in the pharmaceutical industry for the treatment of various bacterial infections. It is also used in veterinary medicine for similar applications. The compound has limited use in other industries such as polymers or semiconductors due to its specific pharmaceutical properties.

About

English Name Azithromycin hydrate
Molecular Formula C38H76N2O14
Molecular Weight 749 g/mol
SMILES CCC1C(C(C(N(CC(CC(C(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)C)O)(C)O.O.O
InChIKey MQTOSJVFKKJCRP-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of Azithromycin hydrate (CAS: 117772-70-0)?

Azithromycin hydrate is an amorphous form of azithromycin with a molecular weight of approximately 9...

Compound Q&A

How is Azithromycin hydrate (CAS: 117772-70-0) typically synthesized?

Azithromycin hydrate is synthesized through a multi-step process involving a key intermediate, 15-de...

Compound Q&A

What precautions should be taken when handling Azithromycin hydrate (CAS: 117772-70-0)?

When handling Azithromycin hydrate, it is essential to use appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...