Compound Q&A

What industries use 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

Answer

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is primarily used in the pharmaceutical industry for the synthesis of drugs that require specific optical properties. It is also utilized in the semiconductor industry for its fluorescence characteristics, making it suitable for use in optoelectronic devices. Additionally, it finds applications in the development of sensors and as a building block in the synthesis of various organic materials.

About

CAS No 8003-22-3
English Name 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO2
Molecular Weight 273.29 g/mol
SMILES O=C1C(c2ccc3c(n2)cccc3)C(=O)c2c1cccc2
InChIKey IZMJMCDDWKSTTK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is a crystalline compound with a molecular...

Compound Q&A

How is 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) typically synthesized?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is usually synthesized via a condensation ...

Compound Q&A

What precautions should be taken when handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

When handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...