Compound Q&A

How is 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) typically synthesized?

Answer

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is usually synthesized via a condensation reaction between 2-quinolinecarboxylic acid and 1H-indene-1,3(2H)-dione, using a suitable base as a catalyst. The process involves mild heating and can achieve a yield of up to 85%, with good selectivity towards the desired product.

About

CAS No 8003-22-3
English Name 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO2
Molecular Weight 273.29 g/mol
SMILES O=C1C(c2ccc3c(n2)cccc3)C(=O)c2c1cccc2
InChIKey IZMJMCDDWKSTTK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is a crystalline compound with a molecular...

Compound Q&A

What industries use 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

When handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...