Compound Q&A

What are the physical and chemical properties of 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

Answer

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is a crystalline compound with a molecular weight of approximately 313.25 g/mol. It has a low solubility in water but is soluble in common organic solvents like dichloromethane and acetonitrile. Chemically, it is relatively stable but can react with strong bases or acids. It also exhibits fluorescence properties, making it useful in various applications requiring optical sensing.

About

CAS No 8003-22-3
English Name 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione
Molecular Formula C18H11NO2
Molecular Weight 273.29 g/mol
SMILES O=C1C(c2ccc3c(n2)cccc3)C(=O)c2c1cccc2
InChIKey IZMJMCDDWKSTTK-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) typically synthesized?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is usually synthesized via a condensation ...

Compound Q&A

What industries use 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3) is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3)?

When handling 2-(2-Quinolinyl)-1H-indene-1,3(2H)-dione (CAS: 8003-22-3), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...