Compound Q&A

What industries use 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

Answer

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is extensively used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of bioactive peptides and proteins, as well as in the development of polymeric materials with enhanced biological and mechanical properties. Its ability to form stable amide bonds makes it valuable in both fields.

About

English Name 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
Molecular Formula C20H19NO4
Molecular Weight 337.38 g/mol
SMILES c1ccc2c(c1)-c3ccccc3C2COC(=O)N4CCC[C@@H]4C(=O)O
InChIKey ZPGDWQNBZYOZTI-GOSISDBHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is a crystalline compound with a m...

Compound Q&A

How is 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) typically synthesized?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) can be synthesized via the condens...

Compound Q&A

What precautions should be taken when handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

When handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...