Compound Q&A

How is 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) typically synthesized?

Answer

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) can be synthesized via the condensation of fluoren-9-ylmethanol with D-proline in the presence of a coupling agent such as 1-hydroxybenzotriazole (HOBt) and a base like 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide (EDC). The reaction yields a high purity product with excellent selectivity and yield, making it a key intermediate in various peptide synthesis applications.

About

English Name 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
Molecular Formula C20H19NO4
Molecular Weight 337.38 g/mol
SMILES c1ccc2c(c1)-c3ccccc3C2COC(=O)N4CCC[C@@H]4C(=O)O
InChIKey ZPGDWQNBZYOZTI-GOSISDBHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is a crystalline compound with a m...

Compound Q&A

What industries use 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is extensively used in the pharmac...

Compound Q&A

What precautions should be taken when handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

When handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...