Compound Q&A

What are the physical and chemical properties of 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

Answer

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is a crystalline compound with a molecular weight of approximately 453.36 g/mol. It has a high solubility in organic solvents such as dimethyl sulfoxide (DMSO) and chloroform. The compound is known for its stability and moderate reactivity in various chemical reactions, particularly in peptide synthesis and medicinal chemistry.

About

English Name 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline
Molecular Formula C20H19NO4
Molecular Weight 337.38 g/mol
SMILES c1ccc2c(c1)-c3ccccc3C2COC(=O)N4CCC[C@@H]4C(=O)O
InChIKey ZPGDWQNBZYOZTI-GOSISDBHSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) typically synthesized?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) can be synthesized via the condens...

Compound Q&A

What industries use 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8) is extensively used in the pharmac...

Compound Q&A

What precautions should be taken when handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8)?

When handling 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-proline (CAS: 101555-62-8), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...