Compound Q&A

What industries use 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

Answer

1-bromo-2-methyl-4-nitro-benzene
1-Bromo-2-methyl-4-nitro-benzene is used in various industries, particularly in the pharmaceutical sector for the synthesis of certain drug intermediates. It also finds applications in the production of dyes, pigments, and as an intermediate in the development of new materials such as polymers and sensors. Its use in semiconductor industry is less common but can be relevant for specific applications requiring specific chemical functionalities.

About

CAS No 7149-70-4
English Name 1-bromo-2-methyl-4-nitro-benzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])Br
InChIKey HIMGPQVBNICCGL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

1-Bromo-2-methyl-4-nitro-benzene is a crystalline solid with a molecular weight of approximately 228...

Compound Q&A

How is 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4) typically synthesized?

1-Bromo-2-methyl-4-nitro-benzene is commonly synthesized through the reaction of 4-nitrobenzyl bromi...

Compound Q&A

What precautions should be taken when handling 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

When handling 1-bromo-2-methyl-4-nitro-benzene, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...