Compound Q&A

How is 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4) typically synthesized?

Answer

1-bromo-2-methyl-4-nitro-benzene
1-Bromo-2-methyl-4-nitro-benzene is commonly synthesized through the reaction of 4-nitrobenzyl bromide with 2-methylphenol in the presence of a base such as sodium hydroxide. The reaction proceeds via a nucleophilic substitution mechanism, yielding the desired product with good selectivity and yield.

About

CAS No 7149-70-4
English Name 1-bromo-2-methyl-4-nitro-benzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])Br
InChIKey HIMGPQVBNICCGL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

1-Bromo-2-methyl-4-nitro-benzene is a crystalline solid with a molecular weight of approximately 228...

Compound Q&A

What industries use 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

1-Bromo-2-methyl-4-nitro-benzene is used in various industries, particularly in the pharmaceutical s...

Compound Q&A

What precautions should be taken when handling 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

When handling 1-bromo-2-methyl-4-nitro-benzene, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...