Compound Q&A

What are the physical and chemical properties of 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

Answer

1-bromo-2-methyl-4-nitro-benzene
1-Bromo-2-methyl-4-nitro-benzene is a crystalline solid with a molecular weight of approximately 228.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol, acetone, and dichloromethane. This compound is known for its reactivity towards nucleophiles, particularly in substitution reactions, and its stability under acidic and basic conditions varies depending on the specific reaction conditions.

About

CAS No 7149-70-4
English Name 1-bromo-2-methyl-4-nitro-benzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=C(C=CC(=C1)[N+](=O)[O-])Br
InChIKey HIMGPQVBNICCGL-UHFFFAOYSA-N
Last Updated: 2025-09-08 00:42

Related Q&A

Compound Q&A

How is 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4) typically synthesized?

1-Bromo-2-methyl-4-nitro-benzene is commonly synthesized through the reaction of 4-nitrobenzyl bromi...

Compound Q&A

What industries use 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

1-Bromo-2-methyl-4-nitro-benzene is used in various industries, particularly in the pharmaceutical s...

Compound Q&A

What precautions should be taken when handling 1-bromo-2-methyl-4-nitro-benzene (CAS: 7149-70-4)?

When handling 1-bromo-2-methyl-4-nitro-benzene, it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...